| id | C00032250 |
|---|---|
| Name | Succinic acid methyl ester / Butanedioic acid 1-methyl ester |
| CAS RN | 3878-55-5 |
| Standard InChI | InChI=1S/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7) |
| Standard InChI (Main Layer) | InChI=1S/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8237 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN | C041105 |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Araliaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Panax notoginseng | 44586 | Araliaceae | asterids | Viridiplantae |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C041105 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | monomethyl succinate inhibits the reaction [bis((2-oxindol-3-ylimino)-2-(2-aminoethyl)pyridine-N,N')copper(II) results in increased expression of TP53 protein] |
decreases reaction
/ increases expression |
protein |
21548882
|