id | C00003232 |
---|---|
Name | Cnicin / (+)-Cnicin |
CAS RN | 24394-09-0 |
Standard InChI | InChI=1S/C20H26O7/c1-11-5-4-6-14(9-21)8-17-18(13(3)20(25)27-17)16(7-11)26-19(24)12(2)15(23)10-22/h5,8,15-18,21-23H,2-4,6-7,9-10H2,1H3/b11-5+,14-8-/t15?,16-,17+,18+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H26O7/c1-11-5-4-6-14(9-21)8-17-18(13(3)20(25)27-17)16(7-11)26-19(24)12(2)15(23)10-22/h5,8,15-18,21-23H,2-4,6-7,9-10H2,1H3 |
Phytochemical cluster | No. 38 |
---|---|
KCF-S cluster | No. 60 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1257707 |
By LinkDB | C09362 |
---|
By CAS RN | C012849 |
---|
class name | count |
---|---|
asterids | 3 |
family name | count |
---|---|
Asteraceae | 3 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Centaurea squarrosa | 41503 | Asteraceae | asterids | Viridiplantae |
Centaurea thessala ssp.attica | 41503 | Asteraceae | asterids | Viridiplantae |
Cnicus benedictus | 50282 | Asteraceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00734 | Prothrombin | S1A | CHEMBL1257707 |
CHEMBL2339330
(1)
|
4 / 2 |
P53582 | Methionine aminopeptidase 1 | M24A | CHEMBL1257707 |
CHEMBL2339332
(1)
|
0 / 0 |
P50579 | Methionine aminopeptidase 2 | M24A | CHEMBL1257707 |
CHEMBL2339331
(1)
|
0 / 0 |