| id | C00003297 | 
|---|---|
| Name | Grosshemin | 
| CAS RN | 22489-66-3 | 
| Standard InChI | InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7,9,11-14,17H,1,3-5H2,2H3/t7-,9+,11+,12+,13-,14-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C15H18O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h7,9,11-14,17H,1,3-5H2,2H3 | 
| Phytochemical cluster | No. 38 | 
|---|---|
| KCF-S cluster | No. 2173 | 
| By standard InChI | CHEMBL271958 | 
|---|---|
| By standard InChI Main Layer | CHEMBL271958 CHEMBL1968792 | 
| By LinkDB | C09472 | 
|---|
| By CAS RN | C007887 | 
|---|
| class name | count | 
|---|---|
| asterids | 5 | 
| family name | count | 
|---|---|
| Asteraceae | 5 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Centaurea lippii | 41503 | Asteraceae | asterids | Viridiplantae | 
| Chartolepis intermedia | 4210 | Asteraceae | asterids | Viridiplantae | 
| Cynara scolymus | 59895 | Asteraceae | asterids | Viridiplantae | 
| Grossheimia macrocephala | 4210 | Asteraceae | asterids | Viridiplantae | 
| Venidium decurrens | 259859 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL271958 | CHEMBL2114784
                        (1) | 1 / 1 | 
| O75496 | Geminin | Unclassified protein | CHEMBL271958 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL271958 | CHEMBL2114788
                        (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL271958 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL271958 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL271958 | CHEMBL1963966
                        (1) | 0 / 0 |