| id | C00033009 |
|---|---|
| Name | Glycocitrine IV |
| CAS RN | 262359-05-7 |
| Standard InChI | InChI=1S/C20H21NO5/c1-10(2)8-9-12-18(24)14-16(20(26-4)19(12)25)21(3)15-11(17(14)23)6-5-7-13(15)22/h5-8,22,24-25H,9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H21NO5/c1-10(2)8-9-12-18(24)14-16(20(26-4)19(12)25)21(3)15-11(17(14)23)6-5-7-13(15)22/h5-8,22,24-25H,9H2,1-4H3 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 469 |
| By standard InChI | CHEMBL463652 |
|---|---|
| By standard InChI Main Layer | CHEMBL463652 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycosmis citrifolia (WILLD.) LINDL. | 68543 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O60911 | Cathepsin L2 | C1A | CHEMBL463652 |
CHEMBL1670879
(1)
CHEMBL1670880
(1)
|
0 / 0 |