| id | C00033138 |
|---|---|
| Name | Madolin A / (+)-Madolin A |
| CAS RN | 205371-29-5 |
| Standard InChI | InChI=1S/C15H22O2/c1-14(2)11-6-7-15(3)13(17-15)5-4-10(9-16)8-12(11)14/h8-9,11-13H,4-7H2,1-3H3/b10-8+/t11-,12+,13-,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O2/c1-14(2)11-6-7-15(3)13(17-15)5-4-10(9-16)8-12(11)14/h8-9,11-13H,4-7H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 500 |
| By standard InChI | CHEMBL1224785 |
|---|---|
| By standard InChI Main Layer | CHEMBL1224785 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Aristolochiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aristolochia cucurbitafolia | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Aristolochia heterophylla Hemsl | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1224785 |
CHEMBL2346141
(1)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL1224785 |
CHEMBL2346141
(1)
|
0 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL1224785 |
CHEMBL1228721
(1)
|
1 / 0 |