| id | C00033155 |
|---|---|
| Name | Makaluvamine A |
| CAS RN | 146555-78-4 |
| Standard InChI | InChI=1S/C11H11N3O/c1-14-5-6-2-3-13-8-4-7(12)11(15)10(14)9(6)8/h4-5H,2-3,12H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C11H11N3O/c1-14-5-6-2-3-13-8-4-7(12)11(15)10(14)9(6)8/h4-5H,2-3,12H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1773 |
| By standard InChI | CHEMBL449905 |
|---|---|
| By standard InChI Main Layer | CHEMBL449905 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Didymiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Didymium bahiense | 289975 | Didymiaceae | Eukaryota | |
| Zyzzya fuliginosa | 1346156 | Metazoa | ||
| Zyzzya sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL449905 |
CHEMBL995331
(1)
CHEMBL2157015
(1)
|
0 / 0 |