| id | C00033266 |
|---|---|
| Name | Oleoside dimethyl ester / (-)-Oleoside dimethyl ester |
| CAS RN | 30164-95-5 |
| Standard InChI | InChI=1S/C18H26O11/c1-4-8-9(5-12(20)25-2)10(16(24)26-3)7-27-17(8)29-18-15(23)14(22)13(21)11(6-19)28-18/h4,7,9,11,13-15,17-19,21-23H,5-6H2,1-3H3/b8-4+/t9-,11+,13+,14-,15+,17-,18-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H26O11/c1-4-8-9(5-12(20)25-2)10(16(24)26-3)7-27-17(8)29-18-15(23)14(22)13(21)11(6-19)28-18/h4,7,9,11,13-15,17-19,21-23H,5-6H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 924 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1087778 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Fraxinus americana | 38872 | Oleaceae | asterids | Viridiplantae |
| Fraxinus excelsior | 38873 | Oleaceae | asterids | Viridiplantae |
| Ligustrum lucidum | 458695 | Oleaceae | asterids | Viridiplantae |
| Syringa afghanica | 24208 | Oleaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14672 | Solute carrier family 2, facilitated glucose transporter member 4 | Unclassified protein | CHEMBL1087778 |
CHEMBL1103148
(1)
|
1 / 0 |
| Q07869 | Peroxisome proliferator-activated receptor alpha | NR1C1 | CHEMBL1087778 |
CHEMBL1103143
(1)
|
0 / 0 |