id | C00033340 |
---|---|
Name | Resacetophenone |
CAS RN | 89-84-9 |
Standard InChI | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
Standard InChI (Main Layer) | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1494 |
By standard InChI | CHEMBL243374 |
---|---|
By standard InChI Main Layer | CHEMBL243374 |
By LinkDB | C03663 |
---|
By CAS RN | C078634 |
---|
class name | count |
---|---|
eudicotyledons | 1 |
family name | count |
---|---|
Paeoniaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Paeonia suffruticosa ANDREWS | 45171 | Paeoniaceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9HAS3 | Solute carrier family 28 member 3 | Unclassified protein | CHEMBL243374 |
CHEMBL957102
(1)
|
0 / 0 |