| id | C00033340 |
|---|---|
| Name | Resacetophenone |
| CAS RN | 89-84-9 |
| Standard InChI | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C8H8O3/c1-5(9)7-3-2-6(10)4-8(7)11/h2-4,10-11H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1494 |
| By standard InChI | CHEMBL243374 |
|---|---|
| By standard InChI Main Layer | CHEMBL243374 |
| By LinkDB | C03663 |
|---|
| By CAS RN | C078634 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Paeoniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Paeonia suffruticosa ANDREWS | 45171 | Paeoniaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9HAS3 | Solute carrier family 28 member 3 | Unclassified protein | CHEMBL243374 |
CHEMBL957102
(1)
|
0 / 0 |