id | C00033964 |
---|---|
Name | Itaconic acid |
CAS RN | 97-65-4 |
Standard InChI | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9) |
Standard InChI (Main Layer) | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5305 |
By standard InChI | CHEMBL359159 |
---|---|
By standard InChI Main Layer | CHEMBL359159 |
By LinkDB | C00490 |
---|
By CAS RN | C005229 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Sapotaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Sebertia acuminata | 280718 | Sapotaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q00987 | E3 ubiquitin-protein ligase Mdm2 | Other nuclear protein | CHEMBL359159 |
CHEMBL853264
(1)
|
1 / 5 |