| id | C00033964 |
|---|---|
| Name | Itaconic acid |
| CAS RN | 97-65-4 |
| Standard InChI | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9) |
| Standard InChI (Main Layer) | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5305 |
| By standard InChI | CHEMBL359159 |
|---|---|
| By standard InChI Main Layer | CHEMBL359159 |
| By LinkDB | C00490 |
|---|
| By CAS RN | C005229 |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Sapotaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sebertia acuminata | 280718 | Sapotaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q00987 | E3 ubiquitin-protein ligase Mdm2 | Other nuclear protein | CHEMBL359159 |
CHEMBL853264
(1)
|
1 / 5 |