| id | C00034313 | 
|---|---|
| Name | Threitol / DL-Tetritol | 
| CAS RN | 7493-90-5 | 
| Standard InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2923 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL349605 CHEMBL402812 | 
| By LinkDB | C16884 | 
|---|
| By CAS RN | C003460 | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Sapotaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Sebertia acuminata | 280718 | Sapotaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL349605 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL402812 | CHEMBL929729
                        (1)
                        CHEMBL929732
                        (1) CHEMBL929735 (1) CHEMBL929738 (1) CHEMBL929741 (1) CHEMBL929744 (1) | 1 / 2 | 
| Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL402812 | CHEMBL929730
                        (1)
                        CHEMBL929731
                        (1) CHEMBL929733 (1) CHEMBL929734 (1) CHEMBL929736 (1) CHEMBL929737 (1) CHEMBL929739 (1) CHEMBL929740 (1) CHEMBL929742 (1) CHEMBL929743 (1) CHEMBL929745 (1) CHEMBL929746 (1) | 0 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 | P00918 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) | P00918
                            (related) | 
| H00436 | Osteopetrosis | P00918
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00021 | Renal cell carcinoma | Q16790
                            (marker) |