| id | C00034476 |
|---|---|
| Name | Dehydropipernonaline |
| CAS RN | 107584-38-3 |
| Standard InChI | InChI=1S/C21H25NO3/c23-21(22-14-8-5-9-15-22)11-7-4-2-1-3-6-10-18-12-13-19-20(16-18)25-17-24-19/h2,4,6-7,10-13,16H,1,3,5,8-9,14-15,17H2/b4-2+,10-6+,11-7+ |
| Standard InChI (Main Layer) | InChI=1S/C21H25NO3/c23-21(22-14-8-5-9-15-22)11-7-4-2-1-3-6-10-18-12-13-19-20(16-18)25-17-24-19/h2,4,6-7,10-13,16H,1,3,5,8-9,14-15,17H2 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 4209 |
| By standard InChI | CHEMBL483708 |
|---|---|
| By standard InChI Main Layer | CHEMBL483708 CHEMBL525259 |
| By LinkDB |
|---|
| By CAS RN | C051966 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Piper nigrum | 13216 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05362 | Intercellular adhesion molecule 1 | Adhesion | CHEMBL483708 CHEMBL525259 |
CHEMBL998767
(2)
CHEMBL998768
(2)
CHEMBL998769 (2) CHEMBL998770 (2) CHEMBL998771 (2) |
1 / 2 |