| id | C00034498 |
|---|---|
| Name | Engelhardic acid |
| CAS RN | 942502-95-6 |
| Standard InChI | InChI=1S/C15H22O2/c1-9(2)12-6-4-10(3)13-7-5-11(15(16)17)8-14(12)13/h8-9,12-14H,3-7H2,1-2H3,(H,16,17)/t12-,13-,14+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H22O2/c1-9(2)12-6-4-10(3)13-7-5-11(15(16)17)8-14(12)13/h8-9,12-14H,3-7H2,1-2H3,(H,16,17) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2025 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Juglandaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Engelhardia roxburghiana | 139932 | Juglandaceae | rosids | Viridiplantae |