| id | C00034760 |
|---|---|
| Name | 2-Decanone |
| CAS RN | 693-54-9 |
| Standard InChI | InChI=1S/C10H20O/c1-3-4-5-6-7-8-9-10(2)11/h3-9H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H20O/c1-3-4-5-6-7-8-9-10(2)11/h3-9H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1738 |
| By standard InChI | CHEMBL47127 |
|---|---|
| By standard InChI Main Layer | CHEMBL47127 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Spongiporus leucomallellus (Murril) |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O00748 | Cocaine esterase | Enzyme | CHEMBL47127 |
CHEMBL657981
(1)
|
0 / 0 |