| id | C00034908 |
|---|---|
| Name | Tribuloside / Tribuloside A |
| CAS RN | 22153-44-2 |
| Standard InChI | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26+,27-,30+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 30 |
| By standard InChI | CHEMBL266564 |
|---|---|
| By standard InChI Main Layer | CHEMBL266564 CHEMBL499705 |
| By LinkDB | C17140 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Zygophyllaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tribulus alatus Del. | 43873 | Zygophyllaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL266564 |
CHEMBL1023248
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL266564 CHEMBL499705 |
CHEMBL999263
(2)
|
0 / 1 |