| id | C00035022 |
|---|---|
| Name | 4-Methoxyphenol |
| CAS RN | 150-76-5 |
| Standard InChI | InChI=1S/C7H8O2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H8O2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2352 |
| By standard InChI | CHEMBL544 |
|---|---|
| By standard InChI Main Layer | CHEMBL544 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dorstenia turbinata | 984821 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51449 | Nuclear receptor ROR-gamma | Nuclear hormone receptor subfamily 1 group F member 3 | CHEMBL544 |
CHEMBL2114842
(1)
|
0 / 0 |
| Q9Y4X1 | UDP-glucuronosyltransferase 2A1 | Enzyme | CHEMBL544 |
CHEMBL1908088
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL544 |
CHEMBL2354311
(1)
|
1 / 0 |