| id | C00035087 |
|---|---|
| Name | Dotriacontanoic acid |
| CAS RN | 3625-52-3 |
| Standard InChI | InChI=1S/C32H64O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32(33)34/h2-31H2,1H3,(H,33,34) |
| Standard InChI (Main Layer) | InChI=1S/C32H64O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32(33)34/h2-31H2,1H3,(H,33,34) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 115 |
| By standard InChI | CHEMBL1917282 |
|---|---|
| By standard InChI Main Layer | CHEMBL1917282 |
| By LinkDB |
|---|
| By CAS RN | C049204 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| rosids | 1 |
| family name | count |
|---|---|
| Piperaceae | 2 |
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Piper betle | 13217 | Piperaceae | Magnoliophyta | Viridiplantae |
| Piper thomsoni | 13215 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51452 | Dual specificity protein phosphatase 3 | Ser_Thr_Tyr | CHEMBL1917282 |
CHEMBL1918613
(1)
|
0 / 0 |
| P35236 | Tyrosine-protein phosphatase non-receptor type 7 | Tyr | CHEMBL1917282 |
CHEMBL1918616
(1)
|
0 / 0 |