id | C00035116 |
---|---|
Name | Isoamyl acetate / 3-Methylbutyl acetate |
CAS RN | 123-92-2 |
Standard InChI | InChI=1S/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C7H14O2/c1-6(2)4-5-9-7(3)8/h6H,4-5H2,1-3H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4683 |
By standard InChI | CHEMBL42013 |
---|---|
By standard InChI Main Layer | CHEMBL42013 |
By LinkDB | C12296 |
---|
By CAS RN | C020377 |
---|
family name | count |
---|---|
Euphorbiaceae | 1 |
Solanaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Croton lechleri Mull.Arg. | 100370 | Euphorbiaceae | rosids | Viridiplantae |
Nicotiana bonariensis | 118694 | Solanaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O75496 | Geminin | Unclassified protein | CHEMBL42013 |
CHEMBL2114780
(1)
|
0 / 0 |