| id | C00035361 |
|---|---|
| Name | Orchioside B / (+)-Orchioside B |
| CAS RN | 851780-22-8 |
| Standard InChI | InChI=1S/C23H26O10/c24-10-18-19(29)20(30)22-23(32-18)31-17(8-7-14(26)11-1-4-13(25)5-2-11)21(33-22)12-3-6-15(27)16(28)9-12/h1-6,9,17-25,27-30H,7-8,10H2/t17-,18-,19-,20+,21-,22-,23-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H26O10/c24-10-18-19(29)20(30)22-23(32-18)31-17(8-7-14(26)11-1-4-13(25)5-2-11)21(33-22)12-3-6-15(27)16(28)9-12/h1-6,9,17-25,27-30H,7-8,10H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4297 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Hypoxidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Curculigo orchioides | 681286 | Hypoxidaceae | Liliopsida | Viridiplantae |