| id | C00035376 |
|---|---|
| Name | Pterocaryanin C |
| CAS RN | 113900-71-3 |
| Standard InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)62-9-23-33(64-37(58)11-3-17(44)27(51)18(45)4-11)34-35(41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12)66-40(61)14-8-22(49)30(54)32(56)25(14)24-13(39(60)65-34)7-21(48)29(53)31(24)55/h1-8,23,33-35,41-56H,9H2 |
| Standard InChI (Main Layer) | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)62-9-23-33(64-37(58)11-3-17(44)27(51)18(45)4-11)34-35(41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12)66-40(61)14-8-22(49)30(54)32(56)25(14)24-13(39(60)65-34)7-21(48)29(53)31(24)55/h1-8,23,33-35,41-56H,9H2 |
| Phytochemical cluster | No. 81 |
|---|---|
| KCF-S cluster | No. 302 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| family name | count |
|---|---|
| Melastomataceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Monochaetum malabathuricum | 113471 | Melastomataceae | rosids | Viridiplantae |
| Monochaetum multiflorum | 113471 | Melastomataceae | rosids | Viridiplantae |
| Monochaetum normale | 113471 | Melastomataceae | rosids | Viridiplantae |