| id | C00035454 |
|---|---|
| Name | 1,3,5-Trimethoxybenzene |
| CAS RN | 621-23-8 |
| Standard InChI | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7496 |
| By standard InChI | CHEMBL1605492 |
|---|---|
| By standard InChI Main Layer | CHEMBL1605492 |
| By LinkDB |
|---|
| By CAS RN | C015560 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Euphorbiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Croton lechleri Mull.Arg. | 100370 | Euphorbiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1605492 |
CHEMBL1614458
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1605492 |
CHEMBL2114780
(1)
|
0 / 0 |