id | C00035454 |
---|---|
Name | 1,3,5-Trimethoxybenzene |
CAS RN | 621-23-8 |
Standard InChI | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C9H12O3/c1-10-7-4-8(11-2)6-9(5-7)12-3/h4-6H,1-3H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7496 |
By standard InChI | CHEMBL1605492 |
---|---|
By standard InChI Main Layer | CHEMBL1605492 |
By LinkDB |
---|
By CAS RN | C015560 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Euphorbiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Croton lechleri Mull.Arg. | 100370 | Euphorbiaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1605492 |
CHEMBL1614458
(1)
|
0 / 0 |
O75496 | Geminin | Unclassified protein | CHEMBL1605492 |
CHEMBL2114780
(1)
|
0 / 0 |