id | C00035757 |
---|---|
Name | Taspine |
CAS RN | 602-07-3 |
Standard InChI | InChI=1S/C20H19NO6/c1-21(2)8-7-10-9-13(25-4)18-16-14(10)20(23)27-17-12(24-3)6-5-11(15(16)17)19(22)26-18/h5-6,9H,7-8H2,1-4H3 |
Standard InChI (Main Layer) | InChI=1S/C20H19NO6/c1-21(2)8-7-10-9-13(25-4)18-16-14(10)20(23)27-17-12(24-3)6-5-11(15(16)17)19(22)26-18/h5-6,9H,7-8H2,1-4H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 7718 |
By standard InChI | CHEMBL470867 |
---|---|
By standard InChI Main Layer | CHEMBL470867 |
By LinkDB |
---|
By CAS RN | C018394 |
---|
class name | count |
---|---|
rosids | 2 |
eudicotyledons | 1 |
Magnoliophyta | 1 |
family name | count |
---|---|
Euphorbiaceae | 2 |
Berberidaceae | 1 |
Magnoliaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Caulophyllum thalictroides | 46963 | Berberidaceae | eudicotyledons | Viridiplantae |
Croton draco Schltdl.& Cham. | 351456 | Euphorbiaceae | rosids | Viridiplantae |
Croton lechleri Mull.Arg. | 100370 | Euphorbiaceae | rosids | Viridiplantae |
Magnolia x soulangiana | 3402 | Magnoliaceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL470867 |
CHEMBL975663
(1)
|
1 / 0 |