| id | C00035789 |
|---|---|
| Name | 2,6-Dimethoxyhydroquinone |
| CAS RN | 15233-65-5 |
| Standard InChI | InChI=1S/C8H10O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,9-10H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C8H10O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4,9-10H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 856 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Macrococculus pomiferus | 1085094 | Menispermaceae | eudicotyledons | Viridiplantae |