| id | C00035949 |
|---|---|
| Name | 4-Hydroxy-3-methoxy-trans-cinnamaldehyde |
| CAS RN | 20649-42-7 |
| Standard InChI | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
| Standard InChI (Main Layer) | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 310 |
| By standard InChI | CHEMBL242529 |
|---|---|
| By standard InChI Main Layer | CHEMBL242529 CHEMBL1956165 |
| By LinkDB | C02666 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Taraxacum formosanum | 170733 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL242529 |
CHEMBL1058545
(1)
CHEMBL2051343
(1)
CHEMBL2051344 (1) |
1 / 1 |