| id | C00036465 | 
|---|---|
| Name | 2,6-Dibromophenol | 
| CAS RN | 608-33-3 | 
| Standard InChI | InChI=1S/C6H4Br2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | 
| Standard InChI (Main Layer) | InChI=1S/C6H4Br2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2101 | 
| By standard InChI | CHEMBL111507 | 
|---|---|
| By standard InChI Main Layer | CHEMBL111507 | 
| By LinkDB | C16247 | 
|---|
| By CAS RN | C038964 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Rhodomelaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Polysiphonia sphaerocarpa | 2804 | Rhodomelaceae | Eukaryota | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P18054 | Arachidonate 12-lipoxygenase, 12S-type | Enzyme | CHEMBL111507 | CHEMBL833559
                        (1) | 2 / 0 | 
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL111507 | CHEMBL831078
                        (1) | 0 / 0 | 
| P18507 | Gamma-aminobutyric acid receptor subunit gamma-2 | GABA-A gamma | CHEMBL111507 | CHEMBL678910
                        (1)
                        CHEMBL678911
                        (1) | 4 / 2 | 
| P47870 | Gamma-aminobutyric acid receptor subunit beta-2 | GABA-A beta | CHEMBL111507 | CHEMBL678910
                        (1)
                        CHEMBL678911
                        (1) | 0 / 0 | 
| P14867 | Gamma-aminobutyric acid receptor subunit alpha-1 | GABA-A alpha | CHEMBL111507 | CHEMBL678910
                        (1)
                        CHEMBL678911
                        (1) | 1 / 1 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C038964 | 1585 | CYP11B2 ALDOS CPN2 CYP11B CYP11BL CYPXIB2 P-450C18 P450C18 P450aldo | cytochrome P450, family 11, subfamily B, polypeptide 2 (EC:1.14.15.4 1.14.15.5) | 2,6-dibromophenol results in decreased expression of CYP11B2 mRNA | decreases expression | mRNA | 17447562 | 
| C038964 | 1586 | CYP17A1 CPT7 CYP17 P450C17 S17AH | cytochrome P450, family 17, subfamily A, polypeptide 1 (EC:1.14.99.9 4.1.2.30) | 2,6-dibromophenol results in decreased expression of CYP17A1 mRNA | decreases expression | mRNA | 17447562 | 
| C038964 | 1589 | CYP21A2 CA21H CAH1 CPS1 CYP21 CYP21B P450c21B | cytochrome P450, family 21, subfamily A, polypeptide 2 (EC:1.14.99.10) | 2,6-dibromophenol results in decreased expression of CYP21A2 mRNA | decreases expression | mRNA | 17447562 | 
| C038964 | 3292 | HSD17B1 EDH17B2 EDHB17 HSD17 SDR28C1 | hydroxysteroid (17-beta) dehydrogenase 1 (EC:1.1.1.62) | 2,6-dibromophenol results in decreased expression of HSD17B1 mRNA | decreases expression | mRNA | 17447562 | 
| C038964 | 3295 | HSD17B4 DBP MFE-2 MPF-2 PRLTS1 SDR8C1 | hydroxysteroid (17-beta) dehydrogenase 4 (EC:4.2.1.107 4.2.1.119 1.1.1.n12) | 2,6-dibromophenol results in decreased expression of HSD17B4 mRNA | decreases expression | mRNA | 17447562 | 
| C038964 | 3284 | HSD3B2 HSD3B HSDB SDR11E2 | hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 (EC:1.1.1.145 5.3.3.1) | 2,6-dibromophenol results in increased expression of HSD3B2 mRNA | increases expression | mRNA | 17447562 | 
| C038964 | 6770 | STAR STARD1 | steroidogenic acute regulatory protein | 2,6-dibromophenol results in decreased expression of STAR mRNA | decreases expression | mRNA | 17447562 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P18054 | 
| #607208 | Dravet syndrome | P18507 | 
| #607681 | Epilepsy, childhood absence, susceptibility to, 2; eca2 | P18507 | 
| #611136 | Epilepsy, juvenile myoclonic, susceptibility to, 5; ejm5 | P14867 | 
| #133239 | Esophageal cancer | P18054 | 
| #604233 | Generalized epilepsy with febrile seizures plus, type 1; gefsp1 | P18507 | 
| #611277 | Generalized epilepsy with febrile seizures plus, type 3; gefsp3 | P18507 |