| id | C00036467 |
|---|---|
| Name | Leonuriside A / 2,6-Dimethoxy-p-hydroquinone 1-O-beta-glucopyranoside |
| CAS RN | 121748-12-7 |
| Standard InChI | InChI=1S/C14H20O9/c1-20-7-3-6(16)4-8(21-2)13(7)23-14-12(19)11(18)10(17)9(5-15)22-14/h3-4,9-12,14-19H,5H2,1-2H3/t9-,10-,11+,12-,14+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H20O9/c1-20-7-3-6(16)4-8(21-2)13(7)23-14-12(19)11(18)10(17)9(5-15)22-14/h3-4,9-12,14-19H,5H2,1-2H3 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 678 |
| By standard InChI | CHEMBL464406 |
|---|---|
| By standard InChI Main Layer | CHEMBL464406 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Acanthaceae | 1 |
| Lamiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acanthus ilicifolius | 328098 | Acanthaceae | asterids | Viridiplantae |
| Clerodendrum inerme | 49994 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL464406 |
CHEMBL980220
(1)
|
0 / 0 |
| P00734 | Prothrombin | S1A | CHEMBL464406 |
CHEMBL976587
(1)
|
4 / 2 |