| id | C00036481 | 
|---|---|
| Name | 2-Bromophenol | 
| CAS RN | 95-56-7 | 
| Standard InChI | InChI=1S/C6H5BrO/c7-5-3-1-2-4-6(5)8/h1-4,8H | 
| Standard InChI (Main Layer) | InChI=1S/C6H5BrO/c7-5-3-1-2-4-6(5)8/h1-4,8H | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2101 | 
| By standard InChI | CHEMBL186007 | 
|---|---|
| By standard InChI Main Layer | CHEMBL186007 | 
| By LinkDB | C14841 | 
|---|
| By CAS RN | C032038 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Rhodomelaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Polysiphonia sphaerocarpa | 2804 | Rhodomelaceae | Eukaryota | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P18054 | Arachidonate 12-lipoxygenase, 12S-type | Enzyme | CHEMBL186007 | CHEMBL833559
                        (1) | 2 / 0 | 
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL186007 | CHEMBL831078
                        (1) | 0 / 0 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C032038 | 1583 | CYP11A1 CYP11A CYPXIA1 P450SCC | cytochrome P450, family 11, subfamily A, polypeptide 1 (EC:1.14.15.6) | 2-bromophenol results in increased expression of CYP11A1 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 1586 | CYP17A1 CPT7 CYP17 P450C17 S17AH | cytochrome P450, family 17, subfamily A, polypeptide 1 (EC:1.14.99.9 4.1.2.30) | 2-bromophenol results in increased expression of CYP17A1 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 1588 | CYP19A1 ARO ARO1 CPV1 CYAR CYP19 CYPXIX P-450AROM | cytochrome P450, family 19, subfamily A, polypeptide 1 (EC:1.14.14.1) | 2-bromophenol results in increased expression of CYP19A1 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 3292 | HSD17B1 EDH17B2 EDHB17 HSD17 SDR28C1 | hydroxysteroid (17-beta) dehydrogenase 1 (EC:1.1.1.62) | 2-bromophenol results in increased expression of HSD17B1 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 3295 | HSD17B4 DBP MFE-2 MPF-2 PRLTS1 SDR8C1 | hydroxysteroid (17-beta) dehydrogenase 4 (EC:4.2.1.107 4.2.1.119 1.1.1.n12) | 2-bromophenol results in increased expression of HSD17B4 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 3284 | HSD3B2 HSD3B HSDB SDR11E2 | hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 (EC:1.1.1.145 5.3.3.1) | 2-bromophenol results in increased expression of HSD3B2 mRNA | increases expression | mRNA | 17447562 | 
| C032038 | 6770 | STAR STARD1 | steroidogenic acute regulatory protein | 2-bromophenol results in increased expression of STAR mRNA | increases expression | mRNA | 17447562 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P18054 | 
| #133239 | Esophageal cancer | P18054 |