| id | C00036483 |
|---|---|
| Name | 2-Deoxy-D-ribono-1,4-lactone |
| CAS RN | 34371-14-7 |
| Standard InChI | InChI=1S/C5H8O4/c6-2-4-3(7)1-5(8)9-4/h3-4,6-7H,1-2H2/t3-,4+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C5H8O4/c6-2-4-3(7)1-5(8)9-4/h3-4,6-7H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 7920 |
| By standard InChI | CHEMBL98888 |
|---|---|
| By standard InChI Main Layer | CHEMBL98888 CHEMBL97916 |
| By LinkDB | C02674 |
|---|
| By CAS RN | C056405 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pimpinella anisum L. | 271192 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43116 | Prostaglandin E2 receptor EP2 subtype | Prostanoid receptor | CHEMBL98888 CHEMBL97916 |
CHEMBL769424
(2)
CHEMBL765912
(1)
|
0 / 0 |