| id | C00036506 |
|---|---|
| Name | 2R-Hydroxymethyl-3S-hydroxypyrrolidine / (+)-2R,3S)-2-(Hydroxymethyl)-3-hydroxypyrrolidine |
| CAS RN | 105017-31-0 |
| Standard InChI | InChI=1S/C5H11NO2/c7-3-4-5(8)1-2-6-4/h4-8H,1-3H2/t4-,5+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C5H11NO2/c7-3-4-5(8)1-2-6-4/h4-8H,1-3H2 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 786 |
| By standard InChI | CHEMBL408355 |
|---|---|
| By standard InChI Main Layer | CHEMBL408355 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Castanospermum australe | 24962 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35573 | Glycogen debranching enzyme | Enzyme | CHEMBL408355 |
CHEMBL923883
(1)
|
1 / 1 |