| id | C00036569 | 
|---|---|
| Name | 4-Bromophenol | 
| CAS RN | 106-41-2 | 
| Standard InChI | InChI=1S/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-4,8H | 
| Standard InChI (Main Layer) | InChI=1S/C6H5BrO/c7-5-1-3-6(8)4-2-5/h1-4,8H | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2101 | 
| By standard InChI | CHEMBL57284 | 
|---|---|
| By standard InChI Main Layer | CHEMBL57284 | 
| By LinkDB | C14453 | 
|---|
| By CAS RN | C032037 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Rhodomelaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Polysiphonia sphaerocarpa | 2804 | Rhodomelaceae | Eukaryota | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P18054 | Arachidonate 12-lipoxygenase, 12S-type | Enzyme | CHEMBL57284 | CHEMBL833559
                        (1) | 2 / 0 | 
| P16050 | Arachidonate 15-lipoxygenase | Enzyme | CHEMBL57284 | CHEMBL831078
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P18054 | 
| #133239 | Esophageal cancer | P18054 |