| id | C00036580 |
|---|---|
| Name | 4-Hydroxylonchocarpin |
| CAS RN | 56083-03-5 |
| Standard InChI | InChI=1S/C20H18O4/c1-20(2)12-11-16-18(24-20)10-8-15(19(16)23)17(22)9-5-13-3-6-14(21)7-4-13/h3-12,21,23H,1-2H3/b9-5+ |
| Standard InChI (Main Layer) | InChI=1S/C20H18O4/c1-20(2)12-11-16-18(24-20)10-8-15(19(16)23)17(22)9-5-13-3-6-14(21)7-4-13/h3-12,21,23H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 130 |
| By standard InChI | CHEMBL362378 |
|---|---|
| By standard InChI Main Layer | CHEMBL362378 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Brosimum acutifolium | 194252 | Moraceae | rosids | Viridiplantae |
| Dorstenia barteri | 106722 | Moraceae | rosids | Viridiplantae |
| Dorstenia mannii | 194258 | Moraceae | rosids | Viridiplantae |
| Dorstenia poinsettifolia | 106722 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11926 | Ornithine decarboxylase | Lyase | CHEMBL362378 |
CHEMBL970064
(1)
|
0 / 0 |