| id | C00036725 |
|---|---|
| Name | Andamanicin |
| CAS RN | 130323-08-9 |
| Standard InChI | InChI=1S/C24H32O6/c1-13-14(2)24(16-10-20(28-6)22(30-8)12-18(16)26-4)23(13)15-9-19(27-5)21(29-7)11-17(15)25-3/h9-14,23-24H,1-8H3/t13-,14-,23?,24?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C24H32O6/c1-13-14(2)24(16-10-20(28-6)22(30-8)12-18(16)26-4)23(13)15-9-19(27-5)21(29-7)11-17(15)25-3/h9-14,23-24H,1-8H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 951 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL345432 CHEMBL156339 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Mosla scabra | 516064 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL156339 |
CHEMBL970954
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL156339 |
CHEMBL970953
(1)
|
0 / 1 |