| id | C00036911 |
|---|---|
| Name | Cistacarpin |
| CAS RN | 645-49-8 |
| Standard InChI | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Standard InChI (Main Layer) | InChI=1S/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3909 |
| By standard InChI | CHEMBL393702 |
|---|---|
| By standard InChI Main Layer | CHEMBL113028 CHEMBL393702 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythrina poeppigiana | 3841 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL393702 |
CHEMBL898096
(1)
|
0 / 0 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL393702 |
CHEMBL1794573
(1)
|
2 / 2 |