| id | C00036912 |
|---|---|
| Name | Cistanoside D |
| CAS RN | 94492-21-4 |
| Standard InChI | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-19(34)21(13-17)41-3)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)20(12-16)40-2/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-19(34)21(13-17)41-3)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)20(12-16)40-2/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 |
| By standard InChI | CHEMBL1714031 |
|---|---|
| By standard InChI Main Layer | CHEMBL1714031 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Scrophulariaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scrophularia ningpoensis | 291326 | Scrophulariaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL1714031 |
CHEMBL1794495
(1)
|
2 / 2 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1714031 |
CHEMBL1738588
(1)
|
0 / 0 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1714031 |
CHEMBL2114738
(1)
|
0 / 0 |