id | C00003768 |
---|---|
Name | Crocetin |
CAS RN | 27876-94-4 |
Standard InChI | InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24)/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+ |
Standard InChI (Main Layer) | InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2031 |
By standard InChI | CHEMBL464792 |
---|---|
By standard InChI Main Layer | CHEMBL464792 CHEMBL1993367 |
By LinkDB | C08588 |
---|
By CAS RN | C010561 |
---|
class name | count |
---|---|
asterids | 1 |
Liliopsida | 1 |
family name | count |
---|---|
Scrophulariaceae | 1 |
Iridaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Crocus sativus | 82528 | Iridaceae | Liliopsida | Viridiplantae |
Verbascum lychnitis | 1000433 | Scrophulariaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL464792 |
CHEMBL1008496
(1)
|
0 / 0 |