| id | C00003769 |
|---|---|
| Name | Crocin / alpha-crocin / Crocetin digentiobioside |
| CAS RN | 42553-65-1 |
| Standard InChI | InChI=1S/C44H64O24/c1-19(11-7-13-21(3)39(59)67-43-37(57)33(53)29(49)25(65-43)17-61-41-35(55)31(51)27(47)23(15-45)63-41)9-5-6-10-20(2)12-8-14-22(4)40(60)68-44-38(58)34(54)30(50)26(66-44)18-62-42-36(56)32(52)28(48)24(16-46)64-42/h5-14,23-38,41-58H,15-18H2,1-4H3/b6-5+,11-7+,12-8+,19-9+,20-10+,21-13+,22-14+/t23?,24?,25?,26?,27-,28-,29-,30-,31+,32+,33+,34+,35?,36?,37?,38?,41-,42-,43+,44+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C44H64O24/c1-19(11-7-13-21(3)39(59)67-43-37(57)33(53)29(49)25(65-43)17-61-41-35(55)31(51)27(47)23(15-45)63-41)9-5-6-10-20(2)12-8-14-22(4)40(60)68-44-38(58)34(54)30(50)26(66-44)18-62-42-36(56)32(52)28(48)24(16-46)64-42/h5-14,23-38,41-58H,15-18H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4277 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL446785 |
| By LinkDB | C08589 |
|---|
| By CAS RN | C029036 |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| asterids | 2 |
| family name | count |
|---|---|
| Iridaceae | 2 |
| Scrophulariaceae | 1 |
| Rubiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Crocus sativa | 58949 | Iridaceae | Liliopsida | Viridiplantae |
| Crocus sativus | 82528 | Iridaceae | Liliopsida | Viridiplantae |
| Gardenia spp. | 43486 | Rubiaceae | asterids | Viridiplantae |
| Safran naturalis | ||||
| Verbascum phlomoides | 90365 | Scrophulariaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL446785 |
CHEMBL1794467
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL446785 |
CHEMBL1794536
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL446785 |
CHEMBL1738442
(1)
|
0 / 0 |