| id | C00037881 |
|---|---|
| Name | Taiwanin C |
| CAS RN | 14944-34-4 |
| Standard InChI | InChI=1S/C20H12O6/c21-20-19-12(7-22-20)3-11-5-16-17(26-9-25-16)6-13(11)18(19)10-1-2-14-15(4-10)24-8-23-14/h1-6H,7-9H2 |
| Standard InChI (Main Layer) | InChI=1S/C20H12O6/c21-20-19-12(7-22-20)3-11-5-16-17(26-9-25-16)6-13(11)18(19)10-1-2-14-15(4-10)24-8-23-14/h1-6H,7-9H2 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 285 |
| By standard InChI | CHEMBL65755 |
|---|---|
| By standard InChI Main Layer | CHEMBL65755 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Phyllanthaceae | 1 |
| Cupressaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Phyllanthus acutissima | 233880 | Phyllanthaceae | rosids | Viridiplantae |
| Taiwania cryptomerioides Hayata | 25613 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P09917 | Arachidonate 5-lipoxygenase | Oxidoreductase | CHEMBL65755 |
CHEMBL693301
(1)
|
0 / 0 |