| id | C00038095 |
|---|---|
| Name | (2R)-8-Methylsocotrin-4'-ol |
| CAS RN | 956103-75-6 |
| Standard InChI | InChI=1S/C32H32O6/c1-19-31(36)28(17-23-9-16-29(38-32(19)23)21-5-12-25(34)13-6-21)27(20-3-10-24(33)11-4-20)15-8-22-7-14-26(35)18-30(22)37-2/h3-7,10-14,17-18,27,29,33-36H,8-9,15-16H2,1-2H3/t27?,29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C32H32O6/c1-19-31(36)28(17-23-9-16-29(38-32(19)23)21-5-12-25(34)13-6-21)27(20-3-10-24(33)11-4-20)15-8-22-7-14-26(35)18-30(22)37-2/h3-7,10-14,17-18,27,29,33-36H,8-9,15-16H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 435 |
| By standard InChI | CHEMBL254647 |
|---|---|
| By standard InChI Main Layer | CHEMBL254647 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Asparagaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dracaena cochinchinensis | 593754 | Asparagaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27487 | Dipeptidyl peptidase 4 | S9B | CHEMBL254647 |
CHEMBL925662
(1)
|
0 / 1 |
| P00734 | Prothrombin | S1A | CHEMBL254647 |
CHEMBL925661
(1)
|
4 / 2 |