| id | C00038095 | 
|---|---|
| Name | (2R)-8-Methylsocotrin-4'-ol | 
| CAS RN | 956103-75-6 | 
| Standard InChI | InChI=1S/C32H32O6/c1-19-31(36)28(17-23-9-16-29(38-32(19)23)21-5-12-25(34)13-6-21)27(20-3-10-24(33)11-4-20)15-8-22-7-14-26(35)18-30(22)37-2/h3-7,10-14,17-18,27,29,33-36H,8-9,15-16H2,1-2H3/t27?,29-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C32H32O6/c1-19-31(36)28(17-23-9-16-29(38-32(19)23)21-5-12-25(34)13-6-21)27(20-3-10-24(33)11-4-20)15-8-22-7-14-26(35)18-30(22)37-2/h3-7,10-14,17-18,27,29,33-36H,8-9,15-16H2,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 435 | 
| By standard InChI | CHEMBL254647 | 
|---|---|
| By standard InChI Main Layer | CHEMBL254647 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Asparagaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dracaena cochinchinensis | 593754 | Asparagaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P27487 | Dipeptidyl peptidase 4 | S9B | CHEMBL254647 | CHEMBL925662
                        (1) | 0 / 1 | 
| P00734 | Prothrombin | S1A | CHEMBL254647 | CHEMBL925661
                        (1) | 4 / 2 |