| id | C00003828 |
|---|---|
| Name | 7,3',4'-Trimethoxyflavone |
| CAS RN | 22395-24-0 |
| Standard InChI | InChI=1S/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL13473 |
|---|---|
| By standard InChI Main Layer | CHEMBL13473 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Umtiza listerana | 162936 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL13473 |
CHEMBL2076249
(1)
|
1 / 0 |