| id | C00003857 |
|---|---|
| Name | Zapotin / 5,6,2',6'-Tetramethoxyflavone / 2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one |
| CAS RN | 14813-19-5 |
| Standard InChI | InChI=1S/C19H18O6/c1-21-12-6-5-7-13(22-2)18(12)16-10-11(20)17-14(25-16)8-9-15(23-3)19(17)24-4/h5-10H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O6/c1-21-12-6-5-7-13(22-2)18(12)16-10-11(20)17-14(25-16)8-9-15(23-3)19(17)24-4/h5-10H,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL375582 |
|---|---|
| By standard InChI Main Layer | CHEMBL375582 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Rutaceae | 3 |
| Primulaceae | 1 |
| Thymelaeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Casimiroa edulis | 68535 | Rutaceae | rosids | Viridiplantae |
| Casimiroa tetrameria | 549413 | Rutaceae | rosids | Viridiplantae |
| Primula veris | 170927 | Primulaceae | asterids | Viridiplantae |
| Sargentia greggii | 23513 | Rutaceae | rosids | Viridiplantae |
| Struthiola argentea | 142714 | Thymelaeaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11926 | Ornithine decarboxylase | Lyase | CHEMBL375582 |
CHEMBL853712
(1)
|
0 / 0 |