| id | C00038582 |
|---|---|
| Name | Bastadin 14 |
| CAS RN | 146345-73-5 |
| Standard InChI | InChI=1S/C34H25Br5N4O8/c35-20-7-16-1-2-27(20)50-28-15-19(11-22(37)30(28)44)13-26(43-49)34(47)40-5-3-17-9-23(38)32(24(39)10-17)51-29-14-18(8-21(36)31(29)45)4-6-41-33(46)25(12-16)42-48/h1-3,5,7-11,14-15,44-45,48-49H,4,6,12-13H2,(H,40,47)(H,41,46)/b5-3-,42-25+,43-26+ |
| Standard InChI (Main Layer) | InChI=1S/C34H25Br5N4O8/c35-20-7-16-1-2-27(20)50-28-15-19(11-22(37)30(28)44)13-26(43-49)34(47)40-5-3-17-9-23(38)32(24(39)10-17)51-29-14-18(8-21(36)31(29)45)4-6-41-33(46)25(12-16)42-48/h1-3,5,7-11,14-15,44-45,48-49H,4,6,12-13H2,(H,40,47)(H,41,46) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 651 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL442828 |
| By LinkDB |
|---|
| By CAS RN | C080231 |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Psammaplysilla purpurea |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL442828 |
CHEMBL1017357
(1)
|
0 / 0 |
| P00374 | Dihydrofolate reductase | Oxidoreductase | CHEMBL442828 |
CHEMBL1017358
(1)
|
1 / 1 |