| id | C00038589 |
|---|---|
| Name | beta-L-Homofuconojirimycin |
| CAS RN | 125711-55-9 |
| Standard InChI | InChI=1S/C7H15NO4/c1-3-5(10)7(12)6(11)4(2-9)8-3/h3-12H,2H2,1H3/t3-,4+,5+,6+,7+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H15NO4/c1-3-5(10)7(12)6(11)4(2-9)8-3/h3-12H,2H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 667 |
| By standard InChI | CHEMBL87474 |
|---|---|
| By standard InChI Main Layer | CHEMBL69294 CHEMBL87474 CHEMBL503021 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Hyacinthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angylocalyx pynaertii | 149630 | Fabaceae | rosids | Viridiplantae |
| Scilla socialis | 4701 | Hyacinthaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9BTY2 | Plasma alpha-L-fucosidase | Enzyme | CHEMBL69294 |
CHEMBL649722
(1)
|
0 / 0 |
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL69294 CHEMBL87474 |
CHEMBL649581
(1)
CHEMBL649591
(1)
CHEMBL649592 (1) CHEMBL819885 (1) CHEMBL819889 (1) |
1 / 2 |
| P06280 | Alpha-galactosidase A | Enzyme | CHEMBL69294 |
CHEMBL646851
(1)
|
1 / 1 |