| id | C00038815 | 
|---|---|
| Name | Cochinchinenene D / (+)-Cochinchinenene D | 
| CAS RN | 956103-74-5 | 
| Standard InChI | InChI=1S/C30H28O6/c1-36-29-18-25(33)14-8-21(29)9-15-27(20-6-12-24(32)13-7-20)30-22(16-26(34)17-28(30)35)5-2-19-3-10-23(31)11-4-19/h2-8,10-14,16-18,27,31-35H,9,15H2,1H3/b5-2+ | 
| Standard InChI (Main Layer) | InChI=1S/C30H28O6/c1-36-29-18-25(33)14-8-21(29)9-15-27(20-6-12-24(32)13-7-20)30-22(16-26(34)17-28(30)35)5-2-19-3-10-23(31)11-4-19/h2-8,10-14,16-18,27,31-35H,9,15H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 435 | 
| By standard InChI | CHEMBL254440 | 
|---|---|
| By standard InChI Main Layer | CHEMBL254440 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Asparagaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dracaena cochinchinensis | 593754 | Asparagaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P27487 | Dipeptidyl peptidase 4 | S9B | CHEMBL254440 | CHEMBL925662
                        (1) | 0 / 1 | 
| P00734 | Prothrombin | S1A | CHEMBL254440 | CHEMBL925661
                        (1) | 4 / 2 |