| id | C00038815 |
|---|---|
| Name | Cochinchinenene D / (+)-Cochinchinenene D |
| CAS RN | 956103-74-5 |
| Standard InChI | InChI=1S/C30H28O6/c1-36-29-18-25(33)14-8-21(29)9-15-27(20-6-12-24(32)13-7-20)30-22(16-26(34)17-28(30)35)5-2-19-3-10-23(31)11-4-19/h2-8,10-14,16-18,27,31-35H,9,15H2,1H3/b5-2+ |
| Standard InChI (Main Layer) | InChI=1S/C30H28O6/c1-36-29-18-25(33)14-8-21(29)9-15-27(20-6-12-24(32)13-7-20)30-22(16-26(34)17-28(30)35)5-2-19-3-10-23(31)11-4-19/h2-8,10-14,16-18,27,31-35H,9,15H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 435 |
| By standard InChI | CHEMBL254440 |
|---|---|
| By standard InChI Main Layer | CHEMBL254440 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Asparagaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dracaena cochinchinensis | 593754 | Asparagaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27487 | Dipeptidyl peptidase 4 | S9B | CHEMBL254440 |
CHEMBL925662
(1)
|
0 / 1 |
| P00734 | Prothrombin | S1A | CHEMBL254440 |
CHEMBL925661
(1)
|
4 / 2 |