| id | C00038989 |
|---|---|
| Name | Deoxyisocalyciphylline B / (-)-Deoxyisocalyciphylline B |
| CAS RN | 619326-75-9 |
| Standard InChI | InChI=1S/C22H31NO2/c1-13-12-23-19-16-5-3-4-14(16)6-7-17(19)21(2)22(11-9-18(24)25-21)10-8-15(13)20(22)23/h5,13-15,17,19-20H,3-4,6-12H2,1-2H3/t13-,14-,15-,17+,19+,20+,21+,22+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H31NO2/c1-13-12-23-19-16-5-3-4-14(16)6-7-17(19)21(2)22(11-9-18(24)25-21)10-8-15(13)20(22)23/h5,13-15,17,19-20H,3-4,6-12H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1167 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Daphniphyllaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Daphniphyllum longeracemosum | 4387 | Daphniphyllaceae | eudicotyledons | Viridiplantae |
| Daphniphyllum oldhami | 1008903 | Daphniphyllaceae | eudicotyledons | Viridiplantae |
| Daphniphyllum subverticillatum | 4387 | Daphniphyllaceae | eudicotyledons | Viridiplantae |