| id | C00039040 |
|---|---|
| Name | Dolaconine / Episcopalitine |
| CAS RN | 82841-75-6 |
| Standard InChI | InChI=1S/C24H37NO5/c1-5-25-11-13-6-7-19(29-4)24-15(13)9-17(22(24)25)23(27)10-18(28-3)14-8-16(24)20(23)21(14)30-12(2)26/h13-22,27H,5-11H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C24H37NO5/c1-5-25-11-13-6-7-19(29-4)24-15(13)9-17(22(24)25)23(27)10-18(28-3)14-8-16(24)20(23)21(14)30-12(2)26/h13-22,27H,5-11H2,1-4H3 |
| Phytochemical cluster | No. 10 |
|---|---|
| KCF-S cluster | No. 31 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN | C067323 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Ranunculaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aconitum episcopale | 226106 | Ranunculaceae | eudicotyledons | Viridiplantae |
| Aconitum toxicum | 49188 | Ranunculaceae | eudicotyledons | Viridiplantae |