| id | C00039393 |
|---|---|
| Name | Hyperielliptone HC |
| CAS RN | 1033905-39-3 |
| Standard InChI | InChI=1S/C25H22O10/c1-30-12-8-14(27)20-16(9-12)34-24-13(21(20)28)4-5-15-25(24)35-19(10-26)23(33-15)11-6-17(31-2)22(29)18(7-11)32-3/h4-9,19,23,26-27,29H,10H2,1-3H3/t19-,23-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H22O10/c1-30-12-8-14(27)20-16(9-12)34-24-13(21(20)28)4-5-15-25(24)35-19(10-26)23(33-15)11-6-17(31-2)22(29)18(7-11)32-3/h4-9,19,23,26-27,29H,10H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 338 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hypericum geminiflorum | 860794 | Hypericaceae | rosids | Viridiplantae |