| id | C00039438 | 
|---|---|
| Name | Isoelaeocarpine / (+)-Isoelaeocarpine | 
| CAS RN | 30891-89-5 | 
| Standard InChI | InChI=1S/C16H19NO2/c1-10-4-2-6-12-14(10)16(18)15-11-5-3-8-17(11)9-7-13(15)19-12/h2,4,6,11,13,15H,3,5,7-9H2,1H3/t11-,13+,15-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C16H19NO2/c1-10-4-2-6-12-14(10)16(18)15-11-5-3-8-17(11)9-7-13(15)19-12/h2,4,6,11,13,15H,3,5,7-9H2,1H3 | 
| Phytochemical cluster | No. 2 | 
|---|---|
| KCF-S cluster | No. 4157 | 
| By standard InChI | CHEMBL608812 | 
|---|---|
| By standard InChI Main Layer | CHEMBL608812 CHEMBL608813 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Elaeocarpaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Elaeocarpus fuscoides | 26005 | Elaeocarpaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL608812 CHEMBL608813 | CHEMBL919363
                        (2) | 0 / 0 |