| id | C00039438 |
|---|---|
| Name | Isoelaeocarpine / (+)-Isoelaeocarpine |
| CAS RN | 30891-89-5 |
| Standard InChI | InChI=1S/C16H19NO2/c1-10-4-2-6-12-14(10)16(18)15-11-5-3-8-17(11)9-7-13(15)19-12/h2,4,6,11,13,15H,3,5,7-9H2,1H3/t11-,13+,15-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H19NO2/c1-10-4-2-6-12-14(10)16(18)15-11-5-3-8-17(11)9-7-13(15)19-12/h2,4,6,11,13,15H,3,5,7-9H2,1H3 |
| Phytochemical cluster | No. 2 |
|---|---|
| KCF-S cluster | No. 4157 |
| By standard InChI | CHEMBL608812 |
|---|---|
| By standard InChI Main Layer | CHEMBL608812 CHEMBL608813 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Elaeocarpaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Elaeocarpus fuscoides | 26005 | Elaeocarpaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL608812 CHEMBL608813 |
CHEMBL919363
(2)
|
0 / 0 |