| id | C00039713 |
|---|---|
| Name | Makaluvamine E |
| CAS RN | 146555-82-0 |
| Standard InChI | InChI=1S/C19H17N3O2/c1-22-11-13-7-9-20-15-10-16(19(24)18(22)17(13)15)21-8-6-12-2-4-14(23)5-3-12/h2-6,8,10-11,21,23H,7,9H2,1H3/b8-6+ |
| Standard InChI (Main Layer) | InChI=1S/C19H17N3O2/c1-22-11-13-7-9-20-15-10-16(19(24)18(22)17(13)15)21-8-6-12-2-4-14(23)5-3-12/h2-6,8,10-11,21,23H,7,9H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1002 |
| By standard InChI | CHEMBL509186 |
|---|---|
| By standard InChI Main Layer | CHEMBL509186 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zyzzya fuliginosa | 1346156 | Metazoa | ||
| Zyzzya sp. |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL509186 |
CHEMBL995331
(1)
|
0 / 0 |