| id | C00003986 |
|---|---|
| Name | 6-Methyltectochrysin / 5-Hydroxy-7-methoxy-6-methylflavone / 5-Hydroxy-7-methoxy-6-methyl-2-phenyl-4H-1-benzopyran-4-one |
| CAS RN | 55969-57-8 |
| Standard InChI | InChI=1S/C17H14O4/c1-10-13(20-2)9-15-16(17(10)19)12(18)8-14(21-15)11-6-4-3-5-7-11/h3-9,19H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O4/c1-10-13(20-2)9-15-16(17(10)19)12(18)8-14(21-15)11-6-4-3-5-7-11/h3-9,19H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL76553 |
|---|---|
| By standard InChI Main Layer | CHEMBL76553 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| Myrtaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hypericum ericoides | 268990 | Hypericaceae | rosids | Viridiplantae |
| Leptospermum scoparium | 295139 | Myrtaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL76553 |
CHEMBL1827948
(1)
|
1 / 0 |
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL76553 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
|
2 / 0 |