| id | C00039870 | 
|---|---|
| Name | Norstictic acid | 
| CAS RN | 571-67-5 | 
| Standard InChI | InChI=1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3496 | 
| By standard InChI | CHEMBL228281 | 
|---|---|
| By standard InChI Main Layer | CHEMBL228281 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Parmeliaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Usnea articulata | 192175 | Parmeliaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P29466 | Caspase-1 | C14 | CHEMBL228281 | CHEMBL1614158
                        (1) | 0 / 0 | 
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL228281 | CHEMBL1794311
                        (1) | 2 / 3 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL228281 | CHEMBL1614458
                        (1) | 0 / 0 | 
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL228281 | CHEMBL1738606
                        (1) | 0 / 0 | 
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL228281 | CHEMBL1794467
                        (1) | 0 / 0 | 
| P18054 | Arachidonate 12-lipoxygenase, 12S-type | Enzyme | CHEMBL228281 | CHEMBL1614252
                        (1) | 2 / 0 | 
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL228281 | CHEMBL1614038
                        (1) | 2 / 2 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL228281 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL228281 | CHEMBL1614211
                        (1) | 0 / 0 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL228281 | CHEMBL1614250
                        (1)
                        CHEMBL1614421
                        (1) CHEMBL1614502 (1) | 4 / 3 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL228281 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL228281 | CHEMBL1613914
                        (1) | 0 / 0 | 
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL228281 | CHEMBL1614364
                        (1)
                        CHEMBL1738394
                        (1) | 1 / 1 | 
| O00255 | Menin | Unclassified protein | CHEMBL228281 | CHEMBL1614257
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL228281 | CHEMBL1614257
                        (1) | 1 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P18054 | 
| #119900 | Digital clubbing, isolated congenital | P15428 | 
| #133239 | Esophageal cancer | P18054 | 
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 | P15428 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #607948 | Mycobacterium tuberculosis, susceptibility to | P11473 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 | Q9NUW8 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a | P11473 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00342 | Tuberculosis | P11473
                            (related) | 
| H00784 | Localized autosomal recessive hypotrichosis | P11473
                            (related) | 
| H01143 | Vitamin D-dependent rickets | P11473
                            (related) | 
| H00457 | Primary hypertrophic osteoarthropathy (PHO) | P15428
                            (related) | 
| H01246 | Isolated congenital nail clubbing (ICNC) | P15428
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q9NUW8
                            (related) |