| id | C00004049 |
|---|---|
| Name | Pongone / 7-(3-Methoxyphenyl)-5H-furo[3,2-g][1]benzopyran-5-one |
| CAS RN | 114687-96-6 |
| Standard InChI | InChI=1S/C18H12O4/c1-20-13-4-2-3-11(7-13)17-9-15(19)14-8-12-5-6-21-16(12)10-18(14)22-17/h2-10H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H12O4/c1-20-13-4-2-3-11(7-13)17-9-15(19)14-8-12-5-6-21-16(12)10-18(14)22-17/h2-10H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL224607 |
|---|---|
| By standard InChI Main Layer | CHEMBL224607 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Millettia pinnata | 56065 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL224607 |
CHEMBL918281
(1)
|
0 / 0 |